For research use only. Not for therapeutic Use.
3-Bromo-5-(trifluoromethyl)benzenesulfonyl chloride is a halogenated aromatic sulfonyl chloride, featuring both bromine and trifluoromethyl groups. This compound is widely used in pharmaceutical and agrochemical synthesis as a reactive intermediate for creating sulfonamide and sulfone derivatives. Its sulfonyl chloride group allows for efficient reactions with amines, enhancing its utility in developing bioactive molecules. With its electron-withdrawing groups, this compound is valuable in medicinal chemistry for synthesizing enzyme inhibitors and other biologically active compounds, providing stability and reactivity.
CAS Number | 351003-46-8 |
Molecular Formula | C7H3BrClF3O2S |
Purity | ≥95% |
IUPAC Name | 3-bromo-5-(trifluoromethyl)benzenesulfonyl chloride |
InChI | InChI=1S/C7H3BrClF3O2S/c8-5-1-4(7(10,11)12)2-6(3-5)15(9,13)14/h1-3H |
InChIKey | YBUJCZFWJSUTSN-UHFFFAOYSA-N |
SMILES | C1=C(C=C(C=C1S(=O)(=O)Cl)Br)C(F)(F)F |