For research use only. Not for therapeutic Use.
3-Bromo-6-chloro-1-methylpyridin-2(1H)-one(CAT: L040408) is a halogenated pyridinone derivative widely used in pharmaceutical and chemical research. Featuring bromine and chlorine substituents along with a methyl group on a pyridinone scaffold, this compound is a versatile intermediate for synthesizing bioactive molecules and complex heterocycles. Its unique structure and reactivity make it particularly valuable in drug discovery, enabling the exploration of structure-activity relationships (SAR) and the development of therapeutic agents. With high purity and stability, 3-Bromo-6-chloro-1-methylpyridin-2(1H)-one supports advanced research in medicinal chemistry and synthetic organic chemistry.
CAS Number | 960299-32-5 |
Molecular Formula | C6H5BrClNO |
Purity | ≥95% |
IUPAC Name | 3-bromo-6-chloro-1-methylpyridin-2-one |
InChI | InChI=1S/C6H5BrClNO/c1-9-5(8)3-2-4(7)6(9)10/h2-3H,1H3 |
InChIKey | OCLAGCKEZUTYND-UHFFFAOYSA-N |
SMILES | CN1C(=CC=C(C1=O)Br)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |