For research use only. Not for therapeutic Use.
3-Bromo-6-chloro-2,5-dimethylpyridine (Cat.No:L003999) is a significant chemical compound in pharmaceutical research. Its unique structure, featuring bromine, chlorine, and methyl substituents, imparts specialized reactivity and properties. This compound serves as a valuable intermediate in the synthesis of specialized molecules with potential pharmaceutical applications.
Catalog Number | L003999 |
CAS Number | 2442597-64-8 |
Molecular Formula | C7H7BrClN |
Purity | ≥95% |
IUPAC Name | 5-bromo-2-chloro-3,6-dimethylpyridine |
InChI | InChI=1S/C7H7BrClN/c1-4-3-6(8)5(2)10-7(4)9/h3H,1-2H3 |
InChIKey | WJYWIIKJRQAUEB-UHFFFAOYSA-N |
SMILES | CC1=CC(=C(N=C1Cl)C)Br |