For research use only. Not for therapeutic Use.
3-Bromo-6-(chloromethyl)-2-methoxypyridine(Cat No.:L016333)is a halogenated pyridine derivative featuring a bromine atom at the 3-position, a chloromethyl group at the 6-position, and a methoxy group at the 2-position. This compound is commonly used in pharmaceutical research and organic synthesis as an intermediate for the development of biologically active molecules and drug candidates. Its halogenated structure provides unique reactivity, particularly in cross-coupling and substitution reactions. Researchers in medicinal chemistry utilize this compound for constructing complex heterocycles and exploring innovative therapeutic agents in drug discovery.
CAS Number | 1227606-83-8 |
Molecular Formula | C7H7BrClNO |
Purity | ≥95% |
IUPAC Name | 3-bromo-6-(chloromethyl)-2-methoxypyridine |
InChI | InChI=1S/C7H7BrClNO/c1-11-7-6(8)3-2-5(4-9)10-7/h2-3H,4H2,1H3 |
InChIKey | JYJCSZTZSDKCGN-UHFFFAOYSA-N |
SMILES | COC1=C(C=CC(=N1)CCl)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |