For research use only. Not for therapeutic Use.
3-Bromo-6-hydrazinylpyridazine(Cat No.:L022031)is a halogenated pyridazine derivative featuring a bromine atom and a hydrazinyl group, making it a valuable intermediate in pharmaceutical research and organic synthesis. This compound is particularly useful in the development of bioactive molecules, including potential drug candidates and enzyme inhibitors. The presence of the hydrazinyl group allows for versatile chemical modifications, enabling the creation of complex molecular structures. With its high reactivity and purity, 3-Bromo-6-hydrazinylpyridazine is essential for advanced applications in medicinal chemistry and the synthesis of heterocyclic compounds.
CAS Number | 64461-67-2 |
Molecular Formula | C4H5BrN4 |
Purity | ≥95% |
IUPAC Name | (6-bromopyridazin-3-yl)hydrazine |
InChI | InChI=1S/C4H5BrN4/c5-3-1-2-4(7-6)9-8-3/h1-2H,6H2,(H,7,9) |
InChIKey | JLKIAAKYEACQJX-UHFFFAOYSA-N |
SMILES | C1=CC(=NN=C1NN)Br |