3-Bromo-6-mercaptopyridine(Cat No.:L043753)is a valuable heterocyclic compound featuring both bromine and thiol (mercapto) functional groups attached to a pyridine ring. This compound is widely utilized in pharmaceutical research and organic synthesis, serving as a key building block for the development of biologically active molecules, including drug candidates and agrochemicals. Its dual functional groups provide versatile reactivity, making it suitable for various chemical transformations, such as cross-coupling reactions. Ideal for researchers in medicinal chemistry, it plays a crucial role in creating innovative compounds with diverse applications.
Catalog Number | L043753 |
CAS Number | 56673-34-8 |
Molecular Formula | C5H4BrNS |
Purity | ≥95% |
IUPAC Name | 5-bromo-1H-pyridine-2-thione |
InChI | InChI=1S/C5H4BrNS/c6-4-1-2-5(8)7-3-4/h1-3H,(H,7,8) |
InChIKey | JPWXLRZTRDTFMR-UHFFFAOYSA-N |
SMILES | C1=CC(=S)NC=C1Br |