For research use only. Not for therapeutic Use.
3-Bromo-6-methyl-1H-indazol-5-amine(Cat No.:L032523)is a specialized heterocyclic compound used in pharmaceutical research and organic synthesis. The indazole core, combined with a bromine atom at the 3-position and a methyl group at the 6-position, provides unique chemical reactivity, making it an ideal intermediate for creating complex molecules. This compound is crucial in the synthesis of kinase inhibitors and other biologically active molecules, playing a significant role in drug discovery and development. Its stability and versatility make it a valuable tool for advanced medicinal chemistry applications.
CAS Number | 1000343-43-0 |
Molecular Formula | C8H8BrN3 |
Purity | ≥95% |
IUPAC Name | 3-bromo-6-methyl-2H-indazol-5-amine |
InChI | InChI=1S/C8H8BrN3/c1-4-2-7-5(3-6(4)10)8(9)12-11-7/h2-3H,10H2,1H3,(H,11,12) |
InChIKey | QANHUNMOMXHWPX-UHFFFAOYSA-N |
SMILES | CC1=CC2=NNC(=C2C=C1N)Br |