For research use only. Not for therapeutic Use.
3-Bromo-6-(pyridin-2-yl)pyridazine is a heterocyclic compound featuring a pyridazine ring substituted with a bromine atom at the 3-position and a pyridine group at the 6-position. This unique structure imparts interesting electronic properties and reactivity, making it valuable in organic synthesis and medicinal chemistry. The bromine substituent can facilitate nucleophilic substitution reactions, while the pyridine moiety may enhance biological activity. This compound may serve as a potential scaffold for developing pharmaceuticals or exploring structure-activity relationships in chemical research.
Catalog Number | L030372 |
CAS Number | 1005036-23-6 |
Molecular Formula | C9H6BrN3 |
Purity | ≥95% |
IUPAC Name | 3-bromo-6-pyridin-2-ylpyridazine |
InChI | InChI=1S/C9H6BrN3/c10-9-5-4-8(12-13-9)7-3-1-2-6-11-7/h1-6H |
InChIKey | QUJNQFBBRLQCAX-UHFFFAOYSA-N |
SMILES | C1=CC=NC(=C1)C2=NN=C(C=C2)Br |