For research use only. Not for therapeutic Use.
3-Bromo-6,8-dichloroimidazo[1,2-a]pyridine(CAT: L041575) is a halogenated heterocyclic compound, known for its significance in medicinal chemistry and as an intermediate in drug discovery. The imidazo[1,2-a]pyridine core is a key scaffold in pharmaceuticals due to its bioactive potential, and the presence of bromine at the 3-position and chlorine atoms at the 6- and 8-positions enhances its reactivity and functional versatility. 3-Bromo-6,8-dichloroimidazo[1,2-a]pyridine is commonly used in the synthesis of compounds targeting various biological pathways, including potential antiviral, anti-inflammatory, and anticancer agents. Its unique structure makes it valuable for exploring structure-activity relationships and optimizing the efficacy of lead compounds in medicinal chemistry.
CAS Number | 952183-48-1 |
Molecular Formula | C7H3BrCl2N2 |
Purity | ≥95% |
IUPAC Name | 3-bromo-6,8-dichloroimidazo[1,2-a]pyridine |
InChI | InChI=1S/C7H3BrCl2N2/c8-6-2-11-7-5(10)1-4(9)3-12(6)7/h1-3H |
InChIKey | CJLKTLUNUJRVNA-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |