For research use only. Not for therapeutic Use.
3-Bromo-7-nitroquinoline is an organic compound with the molecular formula C₉H₆BrN₃O₂. It features a quinoline ring system with a bromine substituent at the 3-position and a nitro group at the 7-position. This compound typically appears as a solid and is of interest in medicinal chemistry for its potential biological activities, including antimicrobial and anticancer properties. Its unique structure allows for various chemical modifications, making it a valuable intermediate for synthesizing diverse bioactive compounds and exploring new therapeutic agents.
CAS Number | 1354221-07-0 |
Molecular Formula | C9H5BrN2O2 |
Purity | ≥95% |
IUPAC Name | 3-bromo-7-nitroquinoline |
InChI | InChI=1S/C9H5BrN2O2/c10-7-3-6-1-2-8(12(13)14)4-9(6)11-5-7/h1-5H |
InChIKey | XIAPLHYFQYRMPL-UHFFFAOYSA-N |
SMILES | C1=CC(=CC2=NC=C(C=C21)Br)[N+](=O)[O-] |