For research use only. Not for therapeutic Use.
3-Bromo-8-chloroquinoline is an organic compound characterized by a quinoline ring system with a bromine atom at the third position and a chlorine atom at the eighth position. Its chemical formula is C₉H₆BrClN. This compound is of interest in medicinal chemistry due to its potential biological activities, including antibacterial and antifungal properties. The presence of halogen substituents enhances its reactivity, making it a valuable scaffold for the development of novel pharmaceuticals and other bioactive compounds through further synthetic modifications.
CAS Number | 205111-94-0 |
Molecular Formula | C9H5BrClN |
Purity | ≥95% |
IUPAC Name | 3-bromo-8-chloroquinoline |
InChI | InChI=1S/C9H5BrClN/c10-7-4-6-2-1-3-8(11)9(6)12-5-7/h1-5H |
InChIKey | OIUOLLAXXIGJHV-UHFFFAOYSA-N |
SMILES | C1=CC2=CC(=CN=C2C(=C1)Cl)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |