For research use only. Not for therapeutic Use.
3-Bromo-m-terphenyl(Cat No.:L007250), is a chemical compound used in organic synthesis and material science. Its molecular formula is C18H13Br. This compound is a member of the terphenyl family, containing a bromine atom at the 3-position. The bromine substituent provides unique reactivity, making it valuable in the synthesis of liquid crystals, organic semiconductors, and other advanced materials. Researchers utilize it as a precursor in the creation of complex organic molecules and functional materials. Its distinct chemical structure and versatile applications contribute significantly to advancements in organic chemistry research and the development of innovative materials.
CAS Number | 98905-03-4 |
Molecular Formula | C18H13Br |
Purity | ≥95% |
IUPAC Name | 1-bromo-3-(3-phenylphenyl)benzene |
InChI | InChI=1S/C18H13Br/c19-18-11-5-10-17(13-18)16-9-4-8-15(12-16)14-6-2-1-3-7-14/h1-13H |
InChIKey | YDFHRBGWDLALOB-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)C2=CC(=CC=C2)C3=CC(=CC=C3)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |