For research use only. Not for therapeutic Use.
3-Bromo-N-methoxy-N-methylbenzamide is an organic compound characterized by a benzamide structure with a bromine atom at the third position and N-methoxy and N-methyl substituents on the nitrogen. Its chemical formula is C₉H₁₃BrN₂O₂. This compound is of interest in medicinal chemistry for its potential biological activities, including antimicrobial and anti-inflammatory properties. The presence of the bromine and methoxy groups enhances its reactivity and solubility, making it a valuable scaffold for drug development and further synthetic applications.
Catalog Number | L015055 |
CAS Number | 207681-67-2 |
Molecular Formula | C9H10BrNO2 |
Purity | ≥95% |
IUPAC Name | 3-bromo-N-methoxy-N-methylbenzamide |
InChI | InChI=1S/C9H10BrNO2/c1-11(13-2)9(12)7-4-3-5-8(10)6-7/h3-6H,1-2H3 |
InChIKey | VPWARUVASBJSPY-UHFFFAOYSA-N |
SMILES | CN(C(=O)C1=CC(=CC=C1)Br)OC |