For research use only. Not for therapeutic Use.
3-bromo-N-phenylaniline (Cat.No:L003510) is a notable chemical compound with applications in pharmaceutical and agrochemical industries. Its distinctive structure incorporates a bromine atom and a phenyl group, imparting specific reactivity and biological properties. This compound serves as a key intermediate in the synthesis of various specialized chemicals, underscoring its significance in modern chemical research.
CAS Number | 88280-58-4 |
Molecular Formula | C12H10BrN |
Purity | ≥95% |
IUPAC Name | 3-bromo-N-phenylaniline |
InChI | InChI=1S/C12H10BrN/c13-10-5-4-8-12(9-10)14-11-6-2-1-3-7-11/h1-9,14H |
InChIKey | IXTBFWCKFRFDOO-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)NC2=CC(=CC=C2)Br |