For research use only. Not for therapeutic Use.
3-Bromo-N,N-dimethyl-1-propylamine hydrobromide is a quaternary ammonium salt used in organic synthesis and pharmaceutical research. Featuring a bromine-substituted propyl chain and a dimethylamine group, it serves as a versatile intermediate in the preparation of various bioactive molecules, including drugs and agrochemicals. The hydrobromide form enhances the compound’s solubility and stability, making it suitable for a range of chemical reactions. Its reactivity is particularly useful in developing complex structures for medicinal chemistry and drug discovery applications.
CAS Number | 5845-30-7 |
Synonyms | 3-bromo-N,N-dimethylpropan-1-amine hydrobromide;3-BroMo-N,N-diMethyl-1-propylaMine HydrobroMide;(3-BROMO-PROPYL)-DIMETHYL-AMINE HBr salt;(3-broMopropyl)diMethylaMine hydrobroMide;3-Bromo-N,N-dimethyl-1-propanamine hydrobromide |
Molecular Formula | C5H13Br2N |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 3-bromo-N,N-dimethylpropan-1-amine;hydrobromide |
InChI | InChI=1S/C5H12BrN.BrH/c1-7(2)5-3-4-6;/h3-5H2,1-2H3;1H |
InChIKey | IDBJSERXBDUKCD-UHFFFAOYSA-N |
SMILES | CN(C)CCCBr.Br |