For research use only. Not for therapeutic Use.
3-Bromo-N,N-dimethylpyridin-2-amine(CAT: L037319) is a halogenated pyridine derivative featuring a bromine atom at the 3-position and a dimethylamino group at the 2-position. This compound is highly valued in synthetic chemistry, particularly in medicinal and agrochemical research, where it serves as a versatile intermediate for constructing complex molecules. The bromine substituent allows for various cross-coupling reactions, facilitating the incorporation of different functional groups, while the dimethylamino group enhances its reactivity and versatility in reaction pathways. Its structural properties make it suitable for developing new pharmacologically active compounds, contributing to advancements in drug discovery and material sciences.
CAS Number | 1060801-39-9 |
Molecular Formula | C7H9BrN2 |
Purity | ≥95% |
IUPAC Name | 3-bromo-N,N-dimethylpyridin-2-amine |
InChI | InChI=1S/C7H9BrN2/c1-10(2)7-6(8)4-3-5-9-7/h3-5H,1-2H3 |
InChIKey | KSVGDNMWQCMHRE-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |