For research use only. Not for therapeutic Use.
3-Bromobenzaldehyde (Cat. No: R019032) is an intermediate for preparing m-phenoxybenzaldehyde, which can synthesize many kinds of pyrethroids. Mainly used as spices, dyes and organic synthetic intermediates.
| Catalog Number | R019032 |
| CAS Number | 3132-99-8 |
| Synonyms | m-Bromobenzaldehyde; 3-Formyl-1-bromobenzene; 3-Formylbromobenzene; 5-Bromobenzaldehyde; NSC 66828 |
| Molecular Formula | C7H5BrO |
| Purity | ≥95% |
| Storage | Store at -20°C |
| IUPAC Name | 3-bromobenzaldehyde |
| InChI | InChI=1S/C7H5BrO/c8-7-3-1-2-6(4-7)5-9/h1-5H |
| InChIKey | SUISZCALMBHJQX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C=O |
