For research use only. Not for therapeutic Use.
3-Bromobenzamide(Cat No.:M090843)is a chemical compound consisting of a benzamide structure substituted with a bromine atom at the 3-position. This molecular arrangement combines the reactivity of bromine with the stability of the benzamide group, making it a versatile intermediate in organic synthesis, particularly for the development of pharmaceuticals and agrochemicals. The bromine atom allows for various nucleophilic substitution reactions, enabling the creation of a wide range of derivative compounds. 3-Bromobenzamide is especially useful in the synthesis of bioactive molecules that require precise structural modifications to achieve desired therapeutic effects.
CAS Number | 22726-00-7 |
Molecular Formula | C7H6BrNO |
Purity | ≥95% |
IUPAC Name | 3-bromobenzamide |
InChI | InChI=1S/C7H6BrNO/c8-6-3-1-2-5(4-6)7(9)10/h1-4H,(H2,9,10) |
InChIKey | ODJFDWIECLJWSR-UHFFFAOYSA-N |
SMILES | C1=CC(=CC(=C1)Br)C(=O)N |