For research use only. Not for therapeutic Use.
3-Bromoimidazo[1,2-a]pyrimidine-2-carbaldehyde(CAT: L032754) is a brominated imidazopyrimidine derivative widely utilized in medicinal chemistry and organic synthesis. This compound features a reactive aldehyde group and a bromine atom on the imidazo[1,2-a]pyrimidine ring, making it a valuable intermediate in constructing bioactive molecules, especially in the development of kinase inhibitors, antiviral agents, and other pharmacologically relevant compounds. Its structural versatility enables it to participate in various chemical reactions, such as cross-coupling or condensation, facilitating the synthesis of diverse heterocyclic scaffolds. 3-Bromoimidazo[1,2-a]pyrimidine-2-carbaldehyde is essential for researchers exploring novel therapeutics and optimizing lead compounds in drug discovery.
Catalog Number | L032754 |
CAS Number | 1018828-40-4 |
Molecular Formula | C7H4BrN3O |
Purity | ≥95% |
IUPAC Name | 3-bromoimidazo[1,2-a]pyrimidine-2-carbaldehyde |
InChI | InChI=1S/C7H4BrN3O/c8-6-5(4-12)10-7-9-2-1-3-11(6)7/h1-4H |
InChIKey | QIHNGBVMGNKXBY-UHFFFAOYSA-N |