For research use only. Not for therapeutic Use.
3-Bromoimidazo[1,2-a]pyrimidine is a heterocyclic compound characterized by an imidazo-pyrimidine structure with a bromine atom at the 3-position. This compound is significant in medicinal chemistry due to its potential biological activities, including antimicrobial and anticancer properties. The presence of the bromine substituent enhances its reactivity, making it a useful intermediate in organic synthesis. Its unique structure allows for further modifications, facilitating the development of novel therapeutic agents and applications in drug discovery and material sciences.
CAS Number | 6840-45-5 |
Molecular Formula | C6H4BrN3 |
Purity | ≥95% |
IUPAC Name | 3-bromoimidazo[1,2-a]pyrimidine |
InChI | InChI=1S/C6H4BrN3/c7-5-4-9-6-8-2-1-3-10(5)6/h1-4H |
InChIKey | GNHZXUKWLSWKHB-UHFFFAOYSA-N |
SMILES | C1=CN2C(=CN=C2N=C1)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |