For research use only. Not for therapeutic Use.
3-(Bromomethyl)-2-chloro-6-fluoropyridine (Cat.No:L003689) is a pivotal chemical compound with diverse applications in pharmaceutical research. Its unique structure, combining halogen-substituted pyridine and bromomethyl functionality, makes it a valuable intermediate in the synthesis of specialized pharmaceuticals. This compound’s versatility and reactivity render it indispensable in the development of novel drug candidates, underscoring its significance in contemporary medicinal chemistry and drug discovery endeavors.
Catalog Number | L003689 |
CAS Number | 1227516-84-8 |
Molecular Formula | C6H4BrClFN |
Purity | ≥95% |
IUPAC Name | 3-(bromomethyl)-2-chloro-6-fluoropyridine |
InChI | InChI=1S/C6H4BrClFN/c7-3-4-1-2-5(9)10-6(4)8/h1-2H,3H2 |
InChIKey | FQCUTRKFAOVBTD-UHFFFAOYSA-N |
SMILES | C1=CC(=NC(=C1CBr)Cl)F |