For research use only. Not for therapeutic Use.
3-(Bromomethyl)benzene-1-sulfonyl fluoride（Cat No.:L007440）, is a chemical compound utilized in various organic synthesis processes. This compound is characterized by the presence of a sulfonyl fluoride functional group, which is a valuable moiety in medicinal chemistry and materials science. Sulfonyl fluorides are known for their reactivity, making them essential intermediates in the synthesis of pharmaceuticals, agrochemicals, and functional materials.
| Catalog Number | L007440 |
| CAS Number | 79686-36-5 |
| Molecular Formula | C7H6BrFO2S |
| Purity | ≥95% |
| IUPAC Name | 3-(bromomethyl)benzenesulfonyl fluoride |
| InChI | InChI=1S/C7H6BrFO2S/c8-5-6-2-1-3-7(4-6)12(9,10)11/h1-4H,5H2 |
| InChIKey | IANRVXMUYOCEIY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)S(=O)(=O)F)CBr |
