For research use only. Not for therapeutic Use.
3-Bromonaphthalen-1-ol(Cat No.:L026820)is an aromatic compound featuring a bromine atom at the 3-position and a hydroxyl group at the 1-position on a naphthalene ring. This compound is widely used as an intermediate in organic synthesis, particularly in the development of pharmaceuticals, agrochemicals, and dyes. The bromine atom provides a reactive site for further chemical modifications, while the hydroxyl group offers versatility in various synthetic pathways. 3-Bromonaphthalen-1-ol is essential for researchers and chemists working on the synthesis of complex molecules and advanced materials.
CAS Number | 90767-17-2 |
Molecular Formula | C10H7BrO |
Purity | ≥95% |
IUPAC Name | 3-bromonaphthalen-1-ol |
InChI | InChI=1S/C10H7BrO/c11-8-5-7-3-1-2-4-9(7)10(12)6-8/h1-6,12H |
InChIKey | QSAZQMOSZQCHHU-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)C=C(C=C2O)Br |