For research use only. Not for therapeutic Use.
3-Bromonaphthalen-2-amine(Cat No.:M347939) is a chemical compound with the molecular formula C10H8BrN. It is an amine derivative of 3-bromonaphthalene, where an amino group (-NH2) is substituted at the 2-position of the naphthalene ring. This compound is used in organic synthesis as a building block for preparing various compounds, including pharmaceuticals, dyes, and agrochemicals. Its unique structure and reactivity make it a valuable intermediate in the synthesis of complex organic molecules. Additionally, 3-bromonaphthalen-2-amine can serve as a precursor for the preparation of functionalized naphthalene derivatives with specific properties and applications.
CAS Number | 54245-33-9 |
Molecular Formula | C10H8BrN |
Purity | ≥95% |
IUPAC Name | 3-bromonaphthalen-2-amine |
InChI | InChI=1S/C10H8BrN/c11-9-5-7-3-1-2-4-8(7)6-10(9)12/h1-6H,12H2 |
InChIKey | XMDCYZRDFRTBQH-UHFFFAOYSA-N |
SMILES | C1=CC=C2C=C(C(=CC2=C1)N)Br |