For research use only. Not for therapeutic Use.
(3-Bromonaphthalen-2-yl)boronic acid(CAT: L000453) is a compound of importance in organic chemistry. It serves as a valuable reagent for various chemical transformations, particularly as a key intermediate in Suzuki-Miyaura cross-coupling reactions. This compound enables the introduction of boron-containing groups into organic molecules, allowing for the diversification of chemical structures.
CAS Number | 1301205-62-8 |
Molecular Formula | C10H8BBrO2 |
Purity | ≥95% |
IUPAC Name | (3-bromonaphthalen-2-yl)boronic acid |
InChI | InChI=1S/C10H8BBrO2/c12-10-6-8-4-2-1-3-7(8)5-9(10)11(13)14/h1-6,13-14H |
InChIKey | MEZCZWDLMIBKID-UHFFFAOYSA-N |