For research use only. Not for therapeutic Use.
(3-Bromophenyl)diphenylphosphine oxide (Cat.No:L004129) is a significant compound in organophosphorus chemistry. Its unique structure, containing a bromophenyl group and phosphine oxide functionality, imparts distinctive reactivity. This compound finds application as a valuable reagent in the synthesis of various organic molecules. It plays a pivotal role in the development of specialized materials and pharmaceuticals, showcasing its importance in contemporary chemical research and industrial processes.
CAS Number | 10212-04-1 |
Molecular Formula | C18H14BrOP |
Purity | ≥95% |
IUPAC Name | 1-bromo-3-diphenylphosphorylbenzene |
InChI | InChI=1S/C18H14BrOP/c19-15-8-7-13-18(14-15)21(20,16-9-3-1-4-10-16)17-11-5-2-6-12-17/h1-14H |
InChIKey | GZZLAPUQZCXKKT-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)P(=O)(C2=CC=CC=C2)C3=CC(=CC=C3)Br |