For research use only. Not for therapeutic Use.
(3-Bromopyridin-2-yl)methanol(CAT: L012388) is a high-purity heterocyclic compound featuring a brominated pyridine ring with a hydroxymethyl functional group. This versatile molecule serves as a critical intermediate in the synthesis of pharmaceuticals, agrochemicals, and fine chemicals. Its unique structure allows for further functionalization, making it ideal for designing bioactive molecules such as enzyme inhibitors, receptor ligands, and complex heterocycles. With excellent stability and reactivity, (3-Bromopyridin-2-yl)methanol supports innovative research in medicinal chemistry, organic synthesis, and advanced material development, offering consistent performance for diverse applications.
Catalog Number | L012388 |
CAS Number | 52378-64-0 |
Molecular Formula | C6H6BrNO |
Purity | ≥95% |
IUPAC Name | (3-bromopyridin-2-yl)methanol |
InChI | InChI=1S/C6H6BrNO/c7-5-2-1-3-8-6(5)4-9/h1-3,9H,4H2 |
InChIKey | FTTLCYCJDYIEFO-UHFFFAOYSA-N |
SMILES | C1=CC(=C(N=C1)CO)Br |