For research use only. Not for therapeutic Use.
3-Butynyl Tosylate (Cat.No:R010923) is a chemical compound used in organic synthesis. It serves as a versatile building block for various reactions, including coupling reactions and cross-coupling reactions. Its unique structure makes it valuable in the preparation of pharmaceuticals, agrochemicals, and other complex organic molecules in the field of chemical research and development.
CAS Number | 23418-85-1 |
Synonyms | 3-Butyn-1-ol 1-(4-Methylbenzenesulfonate); 3-Butyn-1-ol p-Toluenesulfonate; 3-Butyn-1-ol Tosylate; 4-Tosyloxy-1-butyne; 3-Butyn-1-ol Tosylate; 3-Butyn-1-yl p-Toluenesulfonate; 4-Methylbenzenesulfonic Acid 3-butynyl Ester; 4-p-Tolylsulfonyloxy-1-bu |
Molecular Formula | C11H12O3S |
Purity | ≥95% |
Target | ADC Linker |
Storage | Store at 4°C |
IUPAC Name | but-3-ynyl 4-methylbenzenesulfonate |
InChI | InChI=1S/C11H12O3S/c1-3-4-9-14-15(12,13)11-7-5-10(2)6-8-11/h1,5-8H,4,9H2,2H3 |
InChIKey | STOASOOVVADOKH-UHFFFAOYSA-N |
SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCC#C |