For research use only. Not for therapeutic Use.
3-Carbethoxy-2-piperidone is a versatile lactam used in pharmaceutical research and organic synthesis. Its piperidone ring with an ester group at the 3-position makes it a valuable intermediate in the development of bioactive compounds and drug candidates. This compound is frequently employed in the synthesis of heterocyclic molecules and other complex structures, contributing to advancements in medicinal chemistry. Its reactivity allows for a variety of chemical modifications, supporting the design of new therapeutic agents and materials in scientific research.
CAS Number | 3731-16-6 |
Synonyms | 3-Ethoxycarbonyl-2-piperidone |
Molecular Formula | C8H13NO3 |
Purity | ≥95% |
Storage | RT |
IUPAC Name | ethyl 2-oxopiperidine-3-carboxylate |
InChI | InChI=1S/C8H13NO3/c1-2-12-8(11)6-4-3-5-9-7(6)10/h6H,2-5H2,1H3,(H,9,10) |
InChIKey | DUMNOWYWTAYLJN-UHFFFAOYSA-N |
SMILES | CCOC(=O)C1CCCNC1=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |