Home
>
Chemical Reagents>Heterocyclic Building Blocks> 3-Chloro-1-methyl-1H-pyrazole-5-carboxylic acid
For research use only. Not for therapeutic Use.
3-Chloro-1-methyl-1H-pyrazole-5-carboxylic acid(Cat No.:L032137)is a heterocyclic compound with significant applications in pharmaceutical and agrochemical research. Featuring a pyrazole ring with a chlorine atom at the 3-position, a methyl group at the 1-position, and a carboxylic acid group at the 5-position, this compound is a valuable intermediate in the synthesis of bioactive molecules. It is particularly useful in the development of herbicides, fungicides, and therapeutic agents. Its unique structure allows for diverse chemical modifications, making it an essential building block in advanced organic synthesis and drug discovery.
CAS Number | 173841-02-6 |
Molecular Formula | C5H5ClN2O2 |
Purity | ≥95% |
IUPAC Name | 5-chloro-2-methylpyrazole-3-carboxylic acid |
InChI | InChI=1S/C5H5ClN2O2/c1-8-3(5(9)10)2-4(6)7-8/h2H,1H3,(H,9,10) |
InChIKey | CSKGTUGORXMNNS-UHFFFAOYSA-N |
SMILES | CN1C(=CC(=N1)Cl)C(=O)O |