For research use only. Not for therapeutic Use.
3-Chloro-10H-phenothiazine is an organic compound belonging to the phenothiazine class. It is utilized in medicine as an antipsychotic medication, particularly in the treatment of schizophrenia and other psychotic disorders. This compound acts by blocking dopamine receptors in the brain, thereby reducing psychotic symptoms. Additionally, it exhibits antiemetic properties and is sometimes used to manage nausea and vomiting.
CAS Number | 1207-99-4 |
Synonyms | 3-Chloro-phenothiazine; 3-Chlorophenothiazine |
Molecular Formula | C12H8ClNS |
Purity | ≥95% |
Storage | -20 ℃ |
IUPAC Name | 3-chloro-10H-phenothiazine |
InChI | InChI=1S/C12H8ClNS/c13-8-5-6-10-12(7-8)15-11-4-2-1-3-9(11)14-10/h1-7,14H |
InChIKey | DPUVPRWTWNQSOS-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)NC3=C(S2)C=C(C=C3)Cl |