3-Chloro-1,2-propanediol-13C3 is a carbon-13 labeled compound essential for advanced research in pharmaceutical and biochemical fields. Featuring three carbon-13 atoms, this high-purity compound is ideal for studying metabolic pathways, enzyme interactions, and toxicological assessments. Its stable isotope labeling ensures precise and reliable analytical results, making it suitable for pharmacokinetic and pharmacodynamic studies. This compound supports the development of new therapeutic agents and enhances existing research protocols, providing a robust and cost-effective solution for high-precision scientific investigations.
| Catalog Number | R056168 |
| CAS Number | 1391053-60-3 |
| Synonyms | (RS)-3-Chloro-1,2-propanediol-13C3; (RS)-α-Chlorohydrin-13C3; (+/-)-2,3-Dihydroxy-?chloropropane-13C3; (+/-)-3-Chloro-1,2-propanediol-13C3; 1,2-Dihydroxy-3-chloropropane-13C3; 1-Chloro-1-deoxyglycerol-13C3; 3-Chloro-1,2-propylene Glycol-13C3; U 5897 |
| Molecular Formula | C3H7ClO2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 3-chloropropane-1,2-diol |
| InChI | InChI=1S/C3H7ClO2/c4-1-3(6)2-5/h3,5-6H,1-2H2/i1+1,2+1,3+1 |
| InChIKey | SSZWWUDQMAHNAQ-VMIGTVKRSA-N |
| SMILES | C(C(CCl)O)O |
