For research use only. Not for therapeutic Use.
3-Chloro-1,2-propanediol (Cat. No: R048863) can be used as an intermediate in organic synthesis. It can also be used as cellulose acetate solvent, plasticizer, surfactant, and dye intermediate.
| Catalog Number | R048863 |
| CAS Number | 96-24-2 |
| Synonyms | (RS)-3-Chloro-1,2-propanediol; (RS)-α-Chlorohydrin; (+/-)-2,3-Dihydroxy-?chloropropane; (+/-)-3-Chloro-1,2-propanediol; 1,2-Dihydroxy-3-chloropropane; 1-Chloro-1-deoxyglycerol; 3-Chloro-1,2-propylene Glycol; U 5897; dl-α-Chlorohydrin; 3-MCPD |
| Molecular Formula | C3H7ClO2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 3-chloropropane-1,2-diol |
| InChI | InChI=1S/C3H7ClO2/c4-1-3(6)2-5/h3,5-6H,1-2H2 |
| InChIKey | SSZWWUDQMAHNAQ-UHFFFAOYSA-N |
| SMILES | C(C(CCl)O)O |
