For research use only. Not for therapeutic Use.
3-Chloro-2-(3-(trifluoromethyl)phenoxy)pyridine (Cat.No:L003805) is a significant chemical compound with diverse applications. Its unique structure, combining a pyridine and trifluoromethylphenyl ether, grants it distinctive reactivity and properties. This compound serves as a crucial intermediate in the synthesis of specialized materials and pharmaceuticals.
Catalog Number | L003805 |
CAS Number | 197565-66-5 |
Molecular Formula | C12H7ClF3NO |
Purity | ≥95% |
IUPAC Name | 3-chloro-2-[3-(trifluoromethyl)phenoxy]pyridine |
InChI | InChI=1S/C12H7ClF3NO/c13-10-5-2-6-17-11(10)18-9-4-1-3-8(7-9)12(14,15)16/h1-7H |
InChIKey | JHFQIWDOKUTRBA-UHFFFAOYSA-N |
SMILES | C1=CC(=CC(=C1)OC2=C(C=CC=N2)Cl)C(F)(F)F |