For research use only. Not for therapeutic Use.
3-Chloro-2-fluoro-6-methylbenzonitrile(CAT: L000428) is a significant compound used primarily in the field of organic chemistry. This molecule serves as a valuable intermediate in the synthesis of various organic compounds and specialized chemical reagents. Its structural features, including the nitrile group and halogen substitutions, make it instrumental in the development of diverse organic molecules.
| CAS Number | 1807116-67-1 |
| Molecular Formula | C8H5ClFN |
| Purity | ≥95% |
| IUPAC Name | 3-chloro-2-fluoro-6-methylbenzonitrile |
| InChI | InChI=1S/C8H5ClFN/c1-5-2-3-7(9)8(10)6(5)4-11/h2-3H,1H3 |
| InChIKey | HWIPKOXSSUTFSI-UHFFFAOYSA-N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
