For research use only. Not for therapeutic Use.
3-Chloro-2-fluorobenzaldehyde (Cat.No:R030649) is a chemical compound used in organic synthesis. It contains a benzene ring with both chlorine and fluorine substituents, making it valuable as an intermediate in the production of various pharmaceuticals, agrochemicals, and other fine chemicals. Its unique structure allows for the creation of diverse molecular structures.
Catalog Number | R030649 |
CAS Number | 85070-48-0 |
Synonyms | 2-Fluoro-3-chlorobenzaldehyde |
Molecular Formula | C7H4ClFO |
Purity | ≥95% |
Storage | Desiccate at RT |
IUPAC Name | 3-chloro-2-fluorobenzaldehyde |
InChI | InChI=1S/C7H4ClFO/c8-6-3-1-2-5(4-10)7(6)9/h1-4H |
InChIKey | YAOZCMANASAVFN-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C(=C1)Cl)F)C=O |