For research use only. Not for therapeutic Use.
3-Chloro-2-hydroxymethylphenylboronic acid (Cat.No:L003615) is a pivotal chemical compound in organic synthesis. Its unique combination of a boronic acid and a chloro-substituted phenyl ring offers diverse reactivity, making it a valuable building block for the preparation of complex molecules. This compound finds extensive use in the development of pharmaceuticals and advanced materials, showcasing its significance in contemporary chemical research and its role in the creation of innovative compounds for various applications.
CAS Number | 1451393-57-9 |
Molecular Formula | C7H8BClO3 |
Purity | ≥95% |
IUPAC Name | [3-chloro-2-(hydroxymethyl)phenyl]boronic acid |
InChI | InChI=1S/C7H8BClO3/c9-7-3-1-2-6(8(11)12)5(7)4-10/h1-3,10-12H,4H2 |
InChIKey | VDDFRQZITTVMJA-UHFFFAOYSA-N |
SMILES | B(C1=C(C(=CC=C1)Cl)CO)(O)O |