For research use only. Not for therapeutic Use.
3-Chloro-2-hydroxypropanesulfonic acid sodium salt(Cat No.:M070811) is a chemical compound used in various industrial processes, including as a reagent in organic synthesis and as a pH buffer in biochemical applications. Its molecular structure consists of a chlorine atom attached to the second carbon of a three-carbon chain, which is also bound to a hydroxyl group and a sulfonic acid moiety. As a sodium salt, it enhances water solubility, making it easier to handle and dissolve in aqueous solutions. This compound serves diverse roles in chemical research, manufacturing, and pharmaceutical development.
CAS Number | 126-83-0 |
Molecular Formula | C3H6ClNaO4S |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | sodium;3-chloro-2-hydroxypropane-1-sulfonate |
InChI | InChI=1S/C3H7ClO4S.Na/c4-1-3(5)2-9(6,7)8;/h3,5H,1-2H2,(H,6,7,8);/q;+1/p-1 |
InChIKey | TZLNJNUWVOGZJU-UHFFFAOYSA-M |
SMILES | C(C(CCl)O)S(=O)(=O)[O-].[Na+] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |