For research use only. Not for therapeutic Use.
3-Chloro-2-methylbenzamide(Cat No.:L042093)is a versatile chemical compound used in organic synthesis and pharmaceutical research. Featuring a chloro and methyl substitution on a benzamide core, it serves as a key intermediate in the development of various bioactive molecules. This compound is frequently employed in the synthesis of pharmaceutical agents, agrochemicals, and other fine chemicals. Its structure allows for further chemical modifications, making it useful in designing novel compounds for drug discovery and medicinal chemistry. Its reactivity makes it valuable for creating inhibitors, modulators, and other therapeutic agents.
CAS Number | 205178-79-6 |
Molecular Formula | C8H8ClNO |
Purity | ≥95% |
IUPAC Name | 3-chloro-2-methylbenzamide |
InChI | InChI=1S/C8H8ClNO/c1-5-6(8(10)11)3-2-4-7(5)9/h2-4H,1H3,(H2,10,11) |
InChIKey | LBGDADHDWVIRII-UHFFFAOYSA-N |
SMILES | CC1=C(C=CC=C1Cl)C(=O)N |