For research use only. Not for therapeutic Use.
3-Chloro-4-[2-(dimethylamino)ethoxy]aniline(Cat No.:L007344), is a chemical compound with significant applications in research and industry. This compound’s unique structure, incorporating a chlorine atom, an aminoethyl group, and an aniline moiety, makes it valuable in various chemical processes. Researchers utilize it as a key intermediate in the synthesis of complex organic molecules, especially in medicinal chemistry. Its reactivity allows for diverse transformations, contributing to the development of pharmaceuticals and specialty chemicals. Chemists leverage its properties for the design and synthesis of compounds used in biological studies and drug discovery efforts.
CAS Number | 895636-40-5 |
Molecular Formula | C10H15ClN2O |
Purity | ≥95% |
IUPAC Name | 3-chloro-4-[2-(dimethylamino)ethoxy]aniline |
InChI | InChI=1S/C10H15ClN2O/c1-13(2)5-6-14-10-4-3-8(12)7-9(10)11/h3-4,7H,5-6,12H2,1-2H3 |
InChIKey | ICDRPBRANFERPO-UHFFFAOYSA-N |
SMILES | CN(C)CCOC1=C(C=C(C=C1)N)Cl |