For research use only. Not for therapeutic Use.
3-Chloro-4-{[5-(trifluoromethyl)pyridin-2-yl]oxy}(Cat No.:L015025)is a crucial intermediate in the synthesis of advanced pharmaceutical and agrochemical compounds. The trifluoromethyl group and pyridinyl-oxy linkage enhance the compound’s chemical reactivity and potential biological activity, making it a valuable building block in medicinal chemistry. This compound is particularly useful in the development of new therapeutic agents targeting various diseases, as well as in the creation of effective agrochemicals. Its high purity and stability are essential for reliable and precise synthetic applications, supporting innovative research and development efforts.
CAS Number | 72045-93-3 |
Molecular Formula | C12H8ClF3N2O |
Purity | ≥95% |
IUPAC Name | 3-chloro-4-[5-(trifluoromethyl)pyridin-2-yl]oxyaniline |
InChI | InChI=1S/C12H8ClF3N2O/c13-9-5-8(17)2-3-10(9)19-11-4-1-7(6-18-11)12(14,15)16/h1-6H,17H2 |
InChIKey | HHVIOWBCIZNCQQ-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1N)Cl)OC2=NC=C(C=C2)C(F)(F)F |