For research use only. Not for therapeutic Use.
(3-Chloro-4-(chlorocarbonyl)phenyl)boronic Acid(CAT: L035027) is a high-purity boronic acid derivative widely employed in pharmaceutical, chemical, and material science research. Featuring a chlorinated aromatic ring with boronic acid and chlorocarbonyl functional groups, this compound is a versatile intermediate for Suzuki-Miyaura cross-coupling reactions and the synthesis of complex organic molecules. It is particularly valuable in medicinal chemistry for developing bioactive compounds and exploring structure-activity relationships. With excellent stability and reactivity, (3-Chloro-4-(chlorocarbonyl)phenyl)boronic Acid ensures precision and reliability, making it an essential tool for advanced research and innovative synthetic applications.
CAS Number | 850589-38-7 |
Molecular Formula | C7H5BCl2O3 |
Purity | ≥95% |
IUPAC Name | (4-carbonochloridoyl-3-chlorophenyl)boronic acid |
InChI | InChI=1S/C7H5BCl2O3/c9-6-3-4(8(12)13)1-2-5(6)7(10)11/h1-3,12-13H |
InChIKey | OYBLIGPPYFOHAZ-UHFFFAOYSA-N |
SMILES | B(C1=CC(=C(C=C1)C(=O)Cl)Cl)(O)O |