For research use only. Not for therapeutic Use.
3-Chloro-4-cyanobenzenesulfonyl chloride is an aromatic sulfonyl chloride compound characterized by a chloro group, a cyano group, and a sulfonyl chloride functional group attached to a benzene ring. This compound is significant in organic synthesis, serving as a versatile intermediate for the preparation of sulfonamide derivatives and other bioactive molecules. Its reactive sulfonyl chloride group facilitates nucleophilic substitution reactions, making it valuable in medicinal chemistry and the development of pharmaceuticals. Additionally, it is used in the synthesis of various agrochemicals and fine chemicals.
CAS Number | 213130-43-9 |
Molecular Formula | C7H3Cl2NO2S |
Purity | ≥95% |
IUPAC Name | 3-chloro-4-cyanobenzenesulfonyl chloride |
InChI | InChI=1S/C7H3Cl2NO2S/c8-7-3-6(13(9,11)12)2-1-5(7)4-10/h1-3H |
InChIKey | HWCNCOCJCVWMBX-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1S(=O)(=O)Cl)Cl)C#N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |