For research use only. Not for therapeutic Use.
3-Chloro-4′-(ethylthio)benzophenone is an aromatic compound featuring a benzophenone structure with a chlorine atom at the third position and an ethylthio group at the para position. This unique combination enhances its reactivity and electronic properties, making it a valuable intermediate in organic synthesis. The compound may have applications in the production of pharmaceuticals, agrochemicals, and UV-absorbing materials. Its structure allows for various modifications, paving the way for the development of new compounds with potential biological activities and industrial uses.
CAS Number | 844884-99-7 |
Molecular Formula | C15H13ClOS |
Purity | ≥95% |
IUPAC Name | (3-chlorophenyl)-(4-ethylsulfanylphenyl)methanone |
InChI | InChI=1S/C15H13ClOS/c1-2-18-14-8-6-11(7-9-14)15(17)12-4-3-5-13(16)10-12/h3-10H,2H2,1H3 |
InChIKey | OXECCTFHEDCJGL-UHFFFAOYSA-N |
SMILES | CCSC1=CC=C(C=C1)C(=O)C2=CC(=CC=C2)Cl |