For research use only. Not for therapeutic Use.
3-Chloro-4-(methylthio)phenylboronic acid (Cat.No:L003581) is a significant chemical compound with versatile applications in pharmaceutical research. Its unique structure, featuring a boronic acid moiety, makes it a crucial building block for Suzuki-Miyaura cross-coupling reactions. This reaction is pivotal in the synthesis of various biaryl compounds, which are key structural motifs in pharmaceutical agents.
CAS Number | 877383-14-7 |
Molecular Formula | C7H8BClO2S |
Purity | ≥95% |
IUPAC Name | (3-chloro-4-methylsulfanylphenyl)boronic acid |
InChI | InChI=1S/C7H8BClO2S/c1-12-7-3-2-5(8(10)11)4-6(7)9/h2-4,10-11H,1H3 |
InChIKey | XHRBBKXFCXFGTQ-UHFFFAOYSA-N |
SMILES | B(C1=CC(=C(C=C1)SC)Cl)(O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |