For research use only. Not for therapeutic Use.
3-Chloro-4-sulfanylbenzoic acid(Cat No.:L007442), is a chemical compound with the molecular formula C₇H₅ClO₂S. This compound is characterized by a chloro group (Cl) and a thiol group (SH) attached to a benzene ring. It is often utilized in organic synthesis as a building block to create more complex molecules. The chloro and thiol functional groups enable it to participate in various chemical reactions, making it valuable in the production of pharmaceuticals, agrochemicals, and other specialty chemicals. Researchers use it as a key intermediate in the development of novel compounds with potential applications in diverse fields.
CAS Number | 33029-25-3 |
Molecular Formula | C7H5ClO2S |
Purity | ≥95% |
IUPAC Name | 3-chloro-4-sulfanylbenzoic acid |
InChI | InChI=1S/C7H5ClO2S/c8-5-3-4(7(9)10)1-2-6(5)11/h1-3,11H,(H,9,10) |
InChIKey | LTXNOYLJVALMQN-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1C(=O)O)Cl)S |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |