For research use only. Not for therapeutic Use.
3-Chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile is a boronic ester derivative with a nitrile and chlorine group on a benzene ring. This compound is commonly used in Suzuki-Miyaura cross-coupling reactions, making it valuable in the synthesis of complex organic molecules, such as pharmaceuticals and agrochemicals. The boronic ester group enhances its reactivity, allowing for the formation of carbon-carbon bonds. It is often used in drug development and materials science for creating bioactive compounds and advanced materials.
CAS Number | 1212021-11-8 |
Molecular Formula | C13H15BClNO2 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | 3-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile |
InChI | InChI=1S/C13H15BClNO2/c1-12(2)13(3,4)18-14(17-12)10-5-9(8-16)6-11(15)7-10/h5-7H,1-4H3 |
InChIKey | AAZQJHZPPYLORA-UHFFFAOYSA-N |
SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)Cl)C#N |