For research use only. Not for therapeutic Use.
3-Chloro-5-(chlorosulfonyl)-4-hydroxybenzoic acid(Cat No.:L007471), is a chemical compound notable for its unique molecular structure. This compound features a benzene ring with chloro (-Cl), hydroxy (-OH), and chlorosulfonyl (-SO2Cl) functional groups attached at specific positions. Its distinct arrangement of atoms grants it diverse chemical reactivity and makes it valuable in various research and industrial applications. Scientists often utilize it as a reagent in chemical synthesis processes, where its specific functional groups enable the creation of complex organic molecules.
CAS Number | 1201663-81-1 |
Molecular Formula | C7H4Cl2O5S |
Purity | ≥95% |
IUPAC Name | 3-chloro-5-chlorosulfonyl-4-hydroxybenzoic acid |
InChI | InChI=1S/C7H4Cl2O5S/c8-4-1-3(7(11)12)2-5(6(4)10)15(9,13)14/h1-2,10H,(H,11,12) |
InChIKey | AWRFXYMSFNUBMN-UHFFFAOYSA-N |
SMILES | C1=C(C=C(C(=C1S(=O)(=O)Cl)O)Cl)C(=O)O |