For research use only. Not for therapeutic Use.
3-Chloro-5-(difluoromethoxy)benzoic acid(CAT: L002976) is a high-purity aromatic compound featuring a benzoic acid core with a chlorine atom and a difluoromethoxy group as substituents. This versatile molecule is widely used in pharmaceutical and chemical research as a key intermediate for synthesizing complex organic compounds, including bioactive molecules and agrochemicals. Its unique functional groups make it valuable in medicinal chemistry for developing novel therapeutic agents and in material science for innovative applications. With reliable quality and consistent performance, 3-Chloro-5-(difluoromethoxy)benzoic acid supports advanced research in drug discovery, organic synthesis, and material science.
CAS Number | 433926-80-8 |
Molecular Formula | C8H5ClF2O3 |
Purity | ≥95% |
IUPAC Name | 3-chloro-5-(difluoromethoxy)benzoic acid |
InChI | InChI=1S/C8H5ClF2O3/c9-5-1-4(7(12)13)2-6(3-5)14-8(10)11/h1-3,8H,(H,12,13) |
InChIKey | WOQULMFOHBBORM-UHFFFAOYSA-N |
SMILES | C1=C(C=C(C=C1OC(F)F)Cl)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |