For research use only. Not for therapeutic Use.
3-Chloro-5-methoxyisoquinoline(Cat No.:L007175), is a chemical compound with the molecular formula C10H8ClNO. It is an isoquinoline derivative containing a chlorine atom at the 3rd position and a methoxy group at the 5th position of the isoquinoline ring. This compound is valuable in organic synthesis and medicinal chemistry research. Its unique structure makes it a versatile building block for the creation of various bioactive molecules, including potential pharmaceuticals. Researchers utilize 3-chloro-5-methoxyisoquinoline as a key intermediate in the synthesis of diverse organic compounds, contributing to advancements in drug discovery and the development of novel therapeutic agents.
CAS Number | 1691715-12-4 |
Molecular Formula | C10H8ClNO |
Purity | ≥95% |
IUPAC Name | 3-chloro-5-methoxyisoquinoline |
InChI | InChI=1S/C10H8ClNO/c1-13-9-4-2-3-7-6-12-10(11)5-8(7)9/h2-6H,1H3 |
InChIKey | DHXPCSUVTFFVRC-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |